C9H8F2N2O4 — CID 118839869
2-[4-(difluoromethyl)-6-methyl-3-nitro-2-pyridinyl]acetic acid (PubChem CID 118839869) has the molecular formula C9H8F2N2O4 and a molecular weight of 246.17 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-6-methyl-3-nitro-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-(difluoromethyl)-6-methyl-3-nitro-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118839869 |
| Molecular Formula | C9H8F2N2O4 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-[4-(difluoromethyl)-6-methyl-3-nitro-2-pyridinyl]acetic acid |
| SMILES | Cc1cc(C(F)F)c([N+](=O)[O-])c(CC(=O)O)n1 |
| InChI | InChI=1S/C9H8F2N2O4/c1-4-2-5(9(10)11)8(13(16)17)6(12-4)3-7(14)15/h2,9H,3H2,1H3,(H,14,15) |
| InChIKey | IEXUDYWFBFTADV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|