C10H8F5NO2 — CID 118824053
2-[4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]acetic acid (PubChem CID 118824053) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118824053 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-[4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]acetic acid |
| SMILES | Cc1cc(C(F)F)c(CC(=O)O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H8F5NO2/c1-4-2-6(9(11)12)5(3-7(17)18)8(16-4)10(13,14)15/h2,9H,3H2,1H3,(H,17,18) |
| InChIKey | HWXRYRORSKMSRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |