C8H9F3N2 — CID 130080910
[4-(difluoromethyl)-2-fluoro-6-methyl-3-pyridinyl]methanamine (PubChem CID 130080910) has the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. Its IUPAC name is [4-(difluoromethyl)-2-fluoro-6-methyl-3-pyridinyl]methanamine.
| Compound Name | [4-(difluoromethyl)-2-fluoro-6-methyl-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130080910 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | [4-(difluoromethyl)-2-fluoro-6-methyl-3-pyridinyl]methanamine |
| SMILES | Cc1cc(C(F)F)c(CN)c(F)n1 |
| InChI | InChI=1S/C8H9F3N2/c1-4-2-5(7(9)10)6(3-12)8(11)13-4/h2,7H,3,12H2,1H3 |
| InChIKey | QEGWPYKBEGRMEZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|