C9H9F5N2 — CID 130088386
[4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 130088386) has the molecular formula C9H9F5N2 and a molecular weight of 240.18 g/mol. Its IUPAC name is [4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | [4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130088386 |
| Molecular Formula | C9H9F5N2 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | [4-(difluoromethyl)-6-methyl-2-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | Cc1cc(C(F)F)c(CN)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F5N2/c1-4-2-5(8(10)11)6(3-15)7(16-4)9(12,13)14/h2,8H,3,15H2,1H3 |
| InChIKey | KLVXQSNSGUXWHR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |