C8H8F5N3 — CID 118850626
3-(aminomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 118850626) has the molecular formula C8H8F5N3 and a molecular weight of 241.16 g/mol. Its IUPAC name is 3-(aminomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | 3-(aminomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 118850626 |
| Molecular Formula | C8H8F5N3 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(aminomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | NCc1c(C(F)(F)F)ncc(C(F)F)c1N |
| InChI | InChI=1S/C8H8F5N3/c9-7(10)4-2-16-6(8(11,12)13)3(1-14)5(4)15/h2,7H,1,14H2,(H2,15,16) |
| InChIKey | TTYULVJRESQTOI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |