C7H8BrF2N3 — CID 130098692
3-(bromomethyl)-5-(difluoromethyl)pyridine-2,4-diamine (PubChem CID 130098692) has the molecular formula C7H8BrF2N3 and a molecular weight of 252.06 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(difluoromethyl)pyridine-2,4-diamine.
| Compound Name | 3-(bromomethyl)-5-(difluoromethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 130098692 |
| Molecular Formula | C7H8BrF2N3 |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 3-(bromomethyl)-5-(difluoromethyl)pyridine-2,4-diamine |
| SMILES | Nc1ncc(C(F)F)c(N)c1CBr |
| InChI | InChI=1S/C7H8BrF2N3/c8-1-3-5(11)4(6(9)10)2-13-7(3)12/h2,6H,1H2,(H4,11,12,13) |
| InChIKey | JNYDYTABBLNFIT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|