C7H4Br3F2N — CID 130098975
2,3-dibromo-4-(bromomethyl)-5-(difluoromethyl)pyridine (PubChem CID 130098975) has the molecular formula C7H4Br3F2N and a molecular weight of 379.82 g/mol. Its IUPAC name is 2,3-dibromo-4-(bromomethyl)-5-(difluoromethyl)pyridine.
| Compound Name | 2,3-dibromo-4-(bromomethyl)-5-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 130098975 |
| Molecular Formula | C7H4Br3F2N |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 376.79 |
| IUPAC Name | 2,3-dibromo-4-(bromomethyl)-5-(difluoromethyl)pyridine |
| SMILES | FC(F)c1cnc(Br)c(Br)c1CBr |
| InChI | InChI=1S/C7H4Br3F2N/c8-1-3-4(7(11)12)2-13-6(10)5(3)9/h2,7H,1H2 |
| InChIKey | SRQBAQCQHYOPSM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|