C8H7Br2F2NO — CID 130070291
[4-bromo-3-(bromomethyl)-5-(difluoromethyl)-2-pyridinyl]methanol (PubChem CID 130070291) has the molecular formula C8H7Br2F2NO and a molecular weight of 330.95 g/mol. Its IUPAC name is [4-bromo-3-(bromomethyl)-5-(difluoromethyl)-2-pyridinyl]methanol.
| Compound Name | [4-bromo-3-(bromomethyl)-5-(difluoromethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130070291 |
| Molecular Formula | C8H7Br2F2NO |
| Molecular Weight | 330.95 g/mol |
| Exact Mass | 328.89 |
| IUPAC Name | [4-bromo-3-(bromomethyl)-5-(difluoromethyl)-2-pyridinyl]methanol |
| SMILES | OCc1ncc(C(F)F)c(Br)c1CBr |
| InChI | InChI=1S/C8H7Br2F2NO/c9-1-4-6(3-14)13-2-5(7(4)10)8(11)12/h2,8,14H,1,3H2 |
| InChIKey | XKTRETOWNIQWCA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|