C6H3F2I2NO — CID 118843088
6-(difluoromethyl)-4,5-diiodopyridin-3-ol (PubChem CID 118843088) has the molecular formula C6H3F2I2NO and a molecular weight of 396.90 g/mol. Its IUPAC name is 6-(difluoromethyl)-4,5-diiodopyridin-3-ol.
| Compound Name | 6-(difluoromethyl)-4,5-diiodopyridin-3-ol |
|---|---|
| PubChem CID | 118843088 |
| Molecular Formula | C6H3F2I2NO |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.83 |
| IUPAC Name | 6-(difluoromethyl)-4,5-diiodopyridin-3-ol |
| SMILES | Oc1cnc(C(F)F)c(I)c1I |
| InChI | InChI=1S/C6H3F2I2NO/c7-6(8)5-4(10)3(9)2(12)1-11-5/h1,6,12H |
| InChIKey | SKNXIXNHQQGJPU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|