C8H8F2IN — CID 130101179
2-(difluoromethyl)-3-iodo-4,5-dimethylpyridine (PubChem CID 130101179) has the molecular formula C8H8F2IN and a molecular weight of 283.06 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-iodo-4,5-dimethylpyridine.
| Compound Name | 2-(difluoromethyl)-3-iodo-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 130101179 |
| Molecular Formula | C8H8F2IN |
| Molecular Weight | 283.06 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 2-(difluoromethyl)-3-iodo-4,5-dimethylpyridine |
| SMILES | Cc1cnc(C(F)F)c(I)c1C |
| InChI | InChI=1S/C8H8F2IN/c1-4-3-12-7(8(9)10)6(11)5(4)2/h3,8H,1-2H3 |
| InChIKey | RKLJRGIYGJWBQG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.06 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|