C9H10BrF2NO — CID 118843989
[2-(bromomethyl)-6-(difluoromethyl)-3-methyl-4-pyridinyl]methanol (PubChem CID 118843989) has the molecular formula C9H10BrF2NO and a molecular weight of 266.08 g/mol. Its IUPAC name is [2-(bromomethyl)-6-(difluoromethyl)-3-methyl-4-pyridinyl]methanol.
| Compound Name | [2-(bromomethyl)-6-(difluoromethyl)-3-methyl-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 118843989 |
| Molecular Formula | C9H10BrF2NO |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | [2-(bromomethyl)-6-(difluoromethyl)-3-methyl-4-pyridinyl]methanol |
| SMILES | Cc1c(CO)cc(C(F)F)nc1CBr |
| InChI | InChI=1S/C9H10BrF2NO/c1-5-6(4-14)2-7(9(11)12)13-8(5)3-10/h2,9,14H,3-4H2,1H3 |
| InChIKey | UHABULXKTPPXCL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|