C25H33N3O6S — CID 11885058
prop-2-enyl N-[(4S,4aR,7R,8R,8aS)-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]carbamate (PubChem CID 11885058) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is prop-2-enyl N-[(4S,4aR,7R,8R,8aS)-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(4S,4aR,7R,8R,8aS)-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 11885058 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | prop-2-enyl N-[(4S,4aR,7R,8R,8aS)-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1nc2c(s1)C[C@@H]1[C@](C)(CO)[C@H](O)CC[C@@]1(C)[C@@H]2CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C25H33N3O6S/c1-4-9-34-23(32)28-22-27-21-16(11-20(31)26-13-15-6-5-10-33-15)24(2)8-7-19(30)25(3,14-29)18(24)12-17(21)35-22/h4-6,10,16,18-19,29-30H,1,7-9,11-14H2,2-3H3,(H,26,31)(H,27,28,32)/t16-,18+,19-,24+,25+/m1/s1 |
| InChIKey | OJGMHLSGYDVSJM-LDWUQXNOSA-N |
| XLogP | 3.59 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|