C28H33N3O5S — CID 3310012
N-[4-[2-(benzylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]furan-2-carboxamide (PubChem CID 3310012) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-[4-[2-(benzylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(benzylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3310012 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[4-[2-(benzylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]furan-2-carboxamide |
| SMILES | CC1(CO)C(O)CCC2(C)C(CC(=O)NCc3ccccc3)c3nc(NC(=O)c4ccco4)sc3CC12 |
| InChI | InChI=1S/C28H33N3O5S/c1-27-11-10-22(33)28(2,16-32)21(27)14-20-24(30-26(37-20)31-25(35)19-9-6-12-36-19)18(27)13-23(34)29-15-17-7-4-3-5-8-17/h3-9,12,18,21-22,32-33H,10-11,13-16H2,1-2H3,(H,29,34)(H,30,31,35) |
| InChIKey | QELSKIPKRXKGDK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |