C9H7ClF2N2 — CID 118855296
2-[2-(chloromethyl)-3-(difluoromethyl)-4-pyridinyl]acetonitrile (PubChem CID 118855296) has the molecular formula C9H7ClF2N2 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(difluoromethyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(chloromethyl)-3-(difluoromethyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118855296 |
| Molecular Formula | C9H7ClF2N2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(difluoromethyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccnc(CCl)c1C(F)F |
| InChI | InChI=1S/C9H7ClF2N2/c10-5-7-8(9(11)12)6(1-3-13)2-4-14-7/h2,4,9H,1,5H2 |
| InChIKey | ZSFGYNWNMOYLGC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|