C24H19F3N2O3S — CID 118855477
3-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 118855477) has the molecular formula C24H19F3N2O3S and a molecular weight of 472.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 3-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 118855477 |
| Molecular Formula | C24H19F3N2O3S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C24H19F3N2O3S/c1-32-20-11-5-16(6-12-20)22-15-23(17-3-7-18(8-4-17)24(25,26)27)29(28-22)19-9-13-21(14-10-19)33(2,30)31/h3-15H,1-2H3 |
| InChIKey | REYHZMRVWMDCQJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |