C17H14F3N3O3S — CID 10786971
4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide (PubChem CID 10786971) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide.
| Compound Name | 4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10786971 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3O3S/c1-26-13-6-4-12(5-7-13)23-15(10-16(22-23)17(18,19)20)11-2-8-14(9-3-11)27(21,24)25/h2-10H,1H3,(H2,21,24,25) |
| InChIKey | YUDKAOHWTPCIOC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |