C34H49FO3 — CID 11885656
[(3S,8R,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-fluorophenyl) carbonate (PubChem CID 11885656) has the molecular formula C34H49FO3 and a molecular weight of 524.76 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-fluorophenyl) carbonate.
| Compound Name | [(3S,8R,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-fluorophenyl) carbonate |
|---|---|
| PubChem CID | 11885656 |
| Molecular Formula | C34H49FO3 |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-fluorophenyl) carbonate |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)Oc5ccc(F)cc5)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C34H49FO3/c1-22(2)7-6-8-23(3)29-15-16-30-28-14-9-24-21-27(38-32(36)37-26-12-10-25(35)11-13-26)17-19-33(24,4)31(28)18-20-34(29,30)5/h9-13,22-23,27-31H,6-8,14-21H2,1-5H3/t23-,27+,28-,29+,30+,31-,33+,34-/m1/s1 |
| InChIKey | PAWYMVFFEWDGMI-GQQSWYGTSA-N |
| XLogP | 9.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|