C35H52N2O3 — CID 139844224
(4-carbamimidoylphenyl) [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 139844224) has the molecular formula C35H52N2O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | (4-carbamimidoylphenyl) [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 139844224 |
| Molecular Formula | C35H52N2O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | (4-carbamimidoylphenyl) [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@H]4[C@@H]5CC[C@H]([C@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C35H52N2O3/c1-22(2)7-6-8-23(3)29-15-16-30-28-14-11-25-21-27(17-19-34(25,4)31(28)18-20-35(29,30)5)40-33(38)39-26-12-9-24(10-13-26)32(36)37/h9-13,22-23,27-31H,6-8,14-21H2,1-5H3,(H3,36,37)/t23-,27+,28+,29-,30+,31+,34+,35-/m1/s1 |
| InChIKey | GDUSKHHCXBMDCN-QDAKNDIGSA-N |
| XLogP | 8.90 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|