C23H36O3 — CID 118861255
(3S,9S,10S,13S,14S)-9,10,13,14-tetramethylspiro[1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol (PubChem CID 118861255) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3S,9S,10S,13S,14S)-9,10,13,14-tetramethylspiro[1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol.
| Compound Name | (3S,9S,10S,13S,14S)-9,10,13,14-tetramethylspiro[1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
|---|---|
| PubChem CID | 118861255 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3S,9S,10S,13S,14S)-9,10,13,14-tetramethylspiro[1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC1[C@]2(C)CC[C@]2(C)C3(CC[C@@]12C)OCCO3 |
| InChI | InChI=1S/C23H36O3/c1-19-8-7-17(24)15-16(19)5-6-18-20(19,2)9-11-22(4)21(18,3)10-12-23(22)25-13-14-26-23/h5,17-18,24H,6-15H2,1-4H3/t17-,18?,19-,20-,21-,22-/m0/s1 |
| InChIKey | VHAXHNQPGAXZOF-KMPAEFALSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|