C18H15FN2O3S — CID 118862523
2-[4-(4-fluorophenoxy)phenyl]-6-[(sulfinoamino)methyl]pyridine (PubChem CID 118862523) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-6-[(sulfinoamino)methyl]pyridine.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-6-[(sulfinoamino)methyl]pyridine |
|---|---|
| PubChem CID | 118862523 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-6-[(sulfinoamino)methyl]pyridine |
| SMILES | O=S(O)NCc1cccc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C18H15FN2O3S/c19-14-6-10-17(11-7-14)24-16-8-4-13(5-9-16)18-3-1-2-15(21-18)12-20-25(22)23/h1-11,20H,12H2,(H,22,23) |
| InChIKey | XAOYQBRSHRYOPQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|