C23H18FN5O2 — CID 56943461
6-[4-(4-fluorophenoxy)phenyl]-4-(pyrimidin-2-ylmethylamino)pyridine-2-carboxamide (PubChem CID 56943461) has the molecular formula C23H18FN5O2 and a molecular weight of 415.43 g/mol. Its IUPAC name is 6-[4-(4-fluorophenoxy)phenyl]-4-(pyrimidin-2-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | 6-[4-(4-fluorophenoxy)phenyl]-4-(pyrimidin-2-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56943461 |
| Molecular Formula | C23H18FN5O2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 6-[4-(4-fluorophenoxy)phenyl]-4-(pyrimidin-2-ylmethylamino)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NCc2ncccn2)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C23H18FN5O2/c24-16-4-8-19(9-5-16)31-18-6-2-15(3-7-18)20-12-17(13-21(29-20)23(25)30)28-14-22-26-10-1-11-27-22/h1-13H,14H2,(H2,25,30)(H,28,29) |
| InChIKey | HACUGFXGKNVBSC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |