C15H24N4O3 — CID 11886369
(7S,9aR)-N-cyclohexyl-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 11886369) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (7S,9aR)-N-cyclohexyl-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7S,9aR)-N-cyclohexyl-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11886369 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (7S,9aR)-N-cyclohexyl-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | C[C@@H]1NC(=O)[C@H]2CN(C(=O)NC3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C15H24N4O3/c1-10-14(21)19-8-7-18(9-12(19)13(20)16-10)15(22)17-11-5-3-2-4-6-11/h10-12H,2-9H2,1H3,(H,16,20)(H,17,22)/t10-,12+/m0/s1 |
| InChIKey | FWEYHZMCEBGGBE-CMPLNLGQSA-N |
| XLogP | 0.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |