C18H30N4O3 — CID 56859369
(7R,9aR)-N-cyclohexyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 56859369) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (7R,9aR)-N-cyclohexyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7R,9aR)-N-cyclohexyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56859369 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (7R,9aR)-N-cyclohexyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H]1NC(=O)[C@H]2CN(C(=O)NC3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C18H30N4O3/c1-12(2)10-14-17(24)22-9-8-21(11-15(22)16(23)20-14)18(25)19-13-6-4-3-5-7-13/h12-15H,3-11H2,1-2H3,(H,19,25)(H,20,23)/t14-,15-/m1/s1 |
| InChIKey | KAMGIFUPDPAGCV-HUUCEWRRSA-N |
| XLogP | 1.09 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |