C18H16F2N4O5 — CID 118864441
(Z)-but-2-enedioic acid;4-[3-(difluoromethoxy)phenyl]-1-(1H-pyrazol-5-ylmethyl)pyrazole (PubChem CID 118864441) has the molecular formula C18H16F2N4O5 and a molecular weight of 406.35 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[3-(difluoromethoxy)phenyl]-1-(1H-pyrazol-5-ylmethyl)pyrazole.
| Compound Name | (Z)-but-2-enedioic acid;4-[3-(difluoromethoxy)phenyl]-1-(1H-pyrazol-5-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 118864441 |
| Molecular Formula | C18H16F2N4O5 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[3-(difluoromethoxy)phenyl]-1-(1H-pyrazol-5-ylmethyl)pyrazole |
| SMILES | FC(F)Oc1cccc(-c2cnn(Cc3ccn[nH]3)c2)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H12F2N4O.C4H4O4/c15-14(16)21-13-3-1-2-10(6-13)11-7-18-20(8-11)9-12-4-5-17-19-12;5-3(6)1-2-4(7)8/h1-8,14H,9H2,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BZAYPLGTIPHZDS-BTJKTKAUSA-N |
| XLogP | 2.63 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|