C18H21F2N3O3 — CID 118867819
5-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-2-oxo-1H-pyridine-4-carbaldehyde (PubChem CID 118867819) has the molecular formula C18H21F2N3O3 and a molecular weight of 365.38 g/mol. Its IUPAC name is 5-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-2-oxo-1H-pyridine-4-carbaldehyde.
| Compound Name | 5-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-2-oxo-1H-pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 118867819 |
| Molecular Formula | C18H21F2N3O3 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-2-oxo-1H-pyridine-4-carbaldehyde |
| SMILES | O=Cc1cc(=O)[nH]cc1OCC1CCCCC1c1ccnn1CC(F)F |
| InChI | InChI=1S/C18H21F2N3O3/c19-17(20)9-23-15(5-6-22-23)14-4-2-1-3-12(14)11-26-16-8-21-18(25)7-13(16)10-24/h5-8,10,12,14,17H,1-4,9,11H2,(H,21,25) |
| InChIKey | GQLRQUMZKMWIKI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|