C18H21F2N3O3 — CID 90434268
3-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-5-hydroxypyridine-4-carbaldehyde (PubChem CID 90434268) has the molecular formula C18H21F2N3O3 and a molecular weight of 365.38 g/mol. Its IUPAC name is 3-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-5-hydroxypyridine-4-carbaldehyde.
| Compound Name | 3-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-5-hydroxypyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90434268 |
| Molecular Formula | C18H21F2N3O3 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]-5-hydroxypyridine-4-carbaldehyde |
| SMILES | O=Cc1c(O)cncc1OCC1CCCCC1c1ccnn1CC(F)F |
| InChI | InChI=1S/C18H21F2N3O3/c19-18(20)9-23-15(5-6-22-23)13-4-2-1-3-12(13)11-26-17-8-21-7-16(25)14(17)10-24/h5-8,10,12-13,18,25H,1-4,9,11H2 |
| InChIKey | HDYHAHDJWNORIL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|