C18H19ClF3N3O2 — CID 90434163
3-chloro-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]pyridine-4-carbaldehyde (PubChem CID 90434163) has the molecular formula C18H19ClF3N3O2 and a molecular weight of 401.82 g/mol. Its IUPAC name is 3-chloro-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]pyridine-4-carbaldehyde.
| Compound Name | 3-chloro-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90434163 |
| Molecular Formula | C18H19ClF3N3O2 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-chloro-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]cyclohexyl]methoxy]pyridine-4-carbaldehyde |
| SMILES | O=Cc1c(Cl)cncc1OCC1CCCCC1c1ccnn1CC(F)(F)F |
| InChI | InChI=1S/C18H19ClF3N3O2/c19-15-7-23-8-17(14(15)9-26)27-10-12-3-1-2-4-13(12)16-5-6-24-25(16)11-18(20,21)22/h5-9,12-13H,1-4,10-11H2 |
| InChIKey | PPNFGCIEDBTIFK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|