C19H21ClN2O3 — CID 90434047
3-chloro-5-[[2-(2-methoxy-3-pyridinyl)cyclohexyl]methoxy]pyridine-4-carbaldehyde (PubChem CID 90434047) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 3-chloro-5-[[2-(2-methoxy-3-pyridinyl)cyclohexyl]methoxy]pyridine-4-carbaldehyde.
| Compound Name | 3-chloro-5-[[2-(2-methoxy-3-pyridinyl)cyclohexyl]methoxy]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90434047 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-chloro-5-[[2-(2-methoxy-3-pyridinyl)cyclohexyl]methoxy]pyridine-4-carbaldehyde |
| SMILES | COc1ncccc1C1CCCCC1COc1cncc(Cl)c1C=O |
| InChI | InChI=1S/C19H21ClN2O3/c1-24-19-15(7-4-8-22-19)14-6-3-2-5-13(14)12-25-18-10-21-9-17(20)16(18)11-23/h4,7-11,13-14H,2-3,5-6,12H2,1H3 |
| InChIKey | YPILKGSTWJCAED-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|