C18H19NO5 — CID 144715609
2-hydroxy-6-[[(3R)-4-(2-methoxy-3-pyridinyl)oxolan-3-yl]methoxy]benzaldehyde (PubChem CID 144715609) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-hydroxy-6-[[(3R)-4-(2-methoxy-3-pyridinyl)oxolan-3-yl]methoxy]benzaldehyde.
| Compound Name | 2-hydroxy-6-[[(3R)-4-(2-methoxy-3-pyridinyl)oxolan-3-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 144715609 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-hydroxy-6-[[(3R)-4-(2-methoxy-3-pyridinyl)oxolan-3-yl]methoxy]benzaldehyde |
| SMILES | COc1ncccc1C1COC[C@@H]1COc1cccc(O)c1C=O |
| InChI | InChI=1S/C18H19NO5/c1-22-18-13(4-3-7-19-18)15-11-23-9-12(15)10-24-17-6-2-5-16(21)14(17)8-20/h2-8,12,15,21H,9-11H2,1H3/t12-,15?/m1/s1 |
| InChIKey | DAGAHMKVYAEJAE-KEKZHRQWSA-N |
| XLogP | 2.42 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|