C22H25NO6 — CID 146567611
2-hydroxy-6-[[(3S)-4-[2-(2-methoxyethyl)benzoyl]morpholin-3-yl]methoxy]benzaldehyde (PubChem CID 146567611) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-hydroxy-6-[[(3S)-4-[2-(2-methoxyethyl)benzoyl]morpholin-3-yl]methoxy]benzaldehyde.
| Compound Name | 2-hydroxy-6-[[(3S)-4-[2-(2-methoxyethyl)benzoyl]morpholin-3-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 146567611 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-hydroxy-6-[[(3S)-4-[2-(2-methoxyethyl)benzoyl]morpholin-3-yl]methoxy]benzaldehyde |
| SMILES | COCCc1ccccc1C(=O)N1CCOC[C@H]1COc1cccc(O)c1C=O |
| InChI | InChI=1S/C22H25NO6/c1-27-11-9-16-5-2-3-6-18(16)22(26)23-10-12-28-14-17(23)15-29-21-8-4-7-20(25)19(21)13-24/h2-8,13,17,25H,9-12,14-15H2,1H3/t17-/m0/s1 |
| InChIKey | IEXDXGDPWPDCTK-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|