C20H19NO6 — CID 146464658
2-[(3S)-3-[(2-formylphenoxy)methyl]morpholine-4-carbonyl]-6-hydroxybenzaldehyde (PubChem CID 146464658) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 2-[(3S)-3-[(2-formylphenoxy)methyl]morpholine-4-carbonyl]-6-hydroxybenzaldehyde.
| Compound Name | 2-[(3S)-3-[(2-formylphenoxy)methyl]morpholine-4-carbonyl]-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 146464658 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[(3S)-3-[(2-formylphenoxy)methyl]morpholine-4-carbonyl]-6-hydroxybenzaldehyde |
| SMILES | O=Cc1ccccc1OC[C@@H]1COCCN1C(=O)c1cccc(O)c1C=O |
| InChI | InChI=1S/C20H19NO6/c22-10-14-4-1-2-7-19(14)27-13-15-12-26-9-8-21(15)20(25)16-5-3-6-18(24)17(16)11-23/h1-7,10-11,15,24H,8-9,12-13H2/t15-/m0/s1 |
| InChIKey | ATZJOXGIDOJIIH-HNNXBMFYSA-N |
| XLogP | 1.94 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|