C15H19NO5 — CID 146464591
2-ethoxy-6-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]benzaldehyde (PubChem CID 146464591) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-ethoxy-6-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]benzaldehyde.
| Compound Name | 2-ethoxy-6-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]benzaldehyde |
|---|---|
| PubChem CID | 146464591 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-ethoxy-6-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]benzaldehyde |
| SMILES | CCOc1cccc(C(=O)N2CCOC[C@H]2CO)c1C=O |
| InChI | InChI=1S/C15H19NO5/c1-2-21-14-5-3-4-12(13(14)9-18)15(19)16-6-7-20-10-11(16)8-17/h3-5,9,11,17H,2,6-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | NKKNLHYQFQDLMV-LLVKDONJSA-N |
| XLogP | 0.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|