C17H23NO5 — CID 156874450
ethyl 3-[2-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]propanoate (PubChem CID 156874450) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is ethyl 3-[2-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]propanoate.
| Compound Name | ethyl 3-[2-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]propanoate |
|---|---|
| PubChem CID | 156874450 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | ethyl 3-[2-[(3R)-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccccc1C(=O)N1CCOC[C@H]1CO |
| InChI | InChI=1S/C17H23NO5/c1-2-23-16(20)8-7-13-5-3-4-6-15(13)17(21)18-9-10-22-12-14(18)11-19/h3-6,14,19H,2,7-12H2,1H3/t14-/m1/s1 |
| InChIKey | BMGUTLWGMCKSAX-CQSZACIVSA-N |
| XLogP | 1.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |