C20H17FN6O — CID 118869521
4-[4-(6-fluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]morpholine (PubChem CID 118869521) has the molecular formula C20H17FN6O and a molecular weight of 376.40 g/mol. Its IUPAC name is 4-[4-(6-fluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]morpholine.
| Compound Name | 4-[4-(6-fluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 118869521 |
| Molecular Formula | C20H17FN6O |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[4-(6-fluoro-3-pyridinyl)-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-2-yl]morpholine |
| SMILES | Fc1ccc(-c2cc(N3CCOCC3)nc3c(-c4ccn[nH]4)nccc23)cn1 |
| InChI | InChI=1S/C20H17FN6O/c21-17-2-1-13(12-23-17)15-11-18(27-7-9-28-10-8-27)25-19-14(15)3-5-22-20(19)16-4-6-24-26-16/h1-6,11-12H,7-10H2,(H,24,26) |
| InChIKey | CTEHYIAJTWEKPX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|