C21H24N6O2 — CID 134446608
5-[2-morpholin-4-yl-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 134446608) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-[2-morpholin-4-yl-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-[2-morpholin-4-yl-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 134446608 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 5-[2-morpholin-4-yl-8-(1H-pyrazol-5-yl)-1,7-naphthyridin-4-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | c1cc(-c2nccc3c(N4CC5COCC5C4)cc(N4CCOCC4)nc23)[nH]n1 |
| InChI | InChI=1S/C21H24N6O2/c1-3-22-21(17-2-4-23-25-17)20-16(1)18(27-10-14-12-29-13-15(14)11-27)9-19(24-20)26-5-7-28-8-6-26/h1-4,9,14-15H,5-8,10-13H2,(H,23,25) |
| InChIKey | SOCYQBDBFKMTOT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |