C13H16N2O4 — CID 11887153
ethyl (4S,4aR,7aS)-7-acetyl-2-cyano-4a,5,6,7a-tetrahydro-4H-pyrano[2,3-b]pyrrole-4-carboxylate (PubChem CID 11887153) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl (4S,4aR,7aS)-7-acetyl-2-cyano-4a,5,6,7a-tetrahydro-4H-pyrano[2,3-b]pyrrole-4-carboxylate.
| Compound Name | ethyl (4S,4aR,7aS)-7-acetyl-2-cyano-4a,5,6,7a-tetrahydro-4H-pyrano[2,3-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 11887153 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl (4S,4aR,7aS)-7-acetyl-2-cyano-4a,5,6,7a-tetrahydro-4H-pyrano[2,3-b]pyrrole-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C(C#N)O[C@H]2[C@@H]1CCN2C(C)=O |
| InChI | InChI=1S/C13H16N2O4/c1-3-18-13(17)11-6-9(7-14)19-12-10(11)4-5-15(12)8(2)16/h6,10-12H,3-5H2,1-2H3/t10-,11+,12+/m1/s1 |
| InChIKey | KXQJYPJOYLRICX-WOPDTQHZSA-N |
| XLogP | 0.80 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |