C11H13NO4 — CID 95241902
ethyl (3aR,4S,7aR)-6-cyano-3,3a,4,7a-tetrahydro-2H-furo[2,3-b]pyran-4-carboxylate (PubChem CID 95241902) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is ethyl (3aR,4S,7aR)-6-cyano-3,3a,4,7a-tetrahydro-2H-furo[2,3-b]pyran-4-carboxylate.
| Compound Name | ethyl (3aR,4S,7aR)-6-cyano-3,3a,4,7a-tetrahydro-2H-furo[2,3-b]pyran-4-carboxylate |
|---|---|
| PubChem CID | 95241902 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | ethyl (3aR,4S,7aR)-6-cyano-3,3a,4,7a-tetrahydro-2H-furo[2,3-b]pyran-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C(C#N)O[C@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C11H13NO4/c1-2-14-10(13)9-5-7(6-12)16-11-8(9)3-4-15-11/h5,8-9,11H,2-4H2,1H3/t8-,9+,11-/m1/s1 |
| InChIKey | LMLJDJBUISQZKU-WCABBAIRSA-N |
| XLogP | 0.97 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |