C12H20O4 — CID 24749107
ethyl 4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]butanoate (PubChem CID 24749107) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]butanoate.
| Compound Name | ethyl 4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]butanoate |
|---|---|
| PubChem CID | 24749107 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl 4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@H]1CO[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C12H20O4/c1-2-14-11(13)5-3-4-9-8-16-12-10(9)6-7-15-12/h9-10,12H,2-8H2,1H3/t9-,10-,12+/m0/s1 |
| InChIKey | BGUYKZXUEKWKLZ-JBLDHEPKSA-N |
| XLogP | 1.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |