C9H5Cl3O3 — CID 118876298
4-carbonochloridoyl-3,5-dichloro-2-methylbenzoic acid (PubChem CID 118876298) has the molecular formula C9H5Cl3O3 and a molecular weight of 267.50 g/mol. Its IUPAC name is 4-carbonochloridoyl-3,5-dichloro-2-methylbenzoic acid.
| Compound Name | 4-carbonochloridoyl-3,5-dichloro-2-methylbenzoic acid |
|---|---|
| PubChem CID | 118876298 |
| Molecular Formula | C9H5Cl3O3 |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 4-carbonochloridoyl-3,5-dichloro-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)c(C(=O)Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl3O3/c1-3-4(9(14)15)2-5(10)6(7(3)11)8(12)13/h2H,1H3,(H,14,15) |
| InChIKey | ZTHUDMRUTYIZIJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|