C17H16N4O4S — CID 118877088
N-[3-[(2-oxo-1H-pyridine-4-carbonyl)amino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 118877088) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[3-[(2-oxo-1H-pyridine-4-carbonyl)amino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[(2-oxo-1H-pyridine-4-carbonyl)amino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118877088 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[3-[(2-oxo-1H-pyridine-4-carbonyl)amino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2cccs2)on1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C17H16N4O4S/c22-15-9-11(4-7-18-15)16(23)19-5-2-6-20-17(24)12-10-13(25-21-12)14-3-1-8-26-14/h1,3-4,7-10H,2,5-6H2,(H,18,22)(H,19,23)(H,20,24) |
| InChIKey | FNKQUPOJQSJWHZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|