C13H13N5O2S2 — CID 25164516
5-thiophen-2-yl-N-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propyl]-1,2-oxazole-3-carboxamide (PubChem CID 25164516) has the molecular formula C13H13N5O2S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-thiophen-2-yl-N-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-thiophen-2-yl-N-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 25164516 |
| Molecular Formula | C13H13N5O2S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 5-thiophen-2-yl-N-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCSc1ncn[nH]1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C13H13N5O2S2/c19-12(14-4-2-6-22-13-15-8-16-17-13)9-7-10(20-18-9)11-3-1-5-21-11/h1,3,5,7-8H,2,4,6H2,(H,14,19)(H,15,16,17) |
| InChIKey | AYJSXSKDUBFOJW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|