C22H34O3 — CID 11887768
(1'S,2'S,4'R,6'S,8'S,11'S,12'S,16'R)-2',8',16'-trimethylspiro[1,3-dioxolane-2,15'-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane] (PubChem CID 11887768) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (1'S,2'S,4'R,6'S,8'S,11'S,12'S,16'R)-2',8',16'-trimethylspiro[1,3-dioxolane-2,15'-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane].
| Compound Name | (1'S,2'S,4'R,6'S,8'S,11'S,12'S,16'R)-2',8',16'-trimethylspiro[1,3-dioxolane-2,15'-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane] |
|---|---|
| PubChem CID | 11887768 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (1'S,2'S,4'R,6'S,8'S,11'S,12'S,16'R)-2',8',16'-trimethylspiro[1,3-dioxolane-2,15'-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane] |
| SMILES | C[C@@]12CC[C@H]3[C@H](CC[C@]4(C)[C@H]3CCC43OCCO3)[C@]1(C)C[C@H]1O[C@H]1C2 |
| InChI | InChI=1S/C22H34O3/c1-19-7-4-14-15-6-9-22(23-10-11-24-22)20(15,2)8-5-16(14)21(19,3)13-18-17(12-19)25-18/h14-18H,4-13H2,1-3H3/t14-,15+,16+,17+,18-,19+,20-,21+/m1/s1 |
| InChIKey | RCRKFBWQIMSUOE-VTSISHATSA-N |
| XLogP | 4.54 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|