C10H13ClFN3O4 — CID 118878411
4-amino-1-[(2R,3S,4R,5R)-3-chloro-5-(fluoromethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 118878411) has the molecular formula C10H13ClFN3O4 and a molecular weight of 293.68 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5R)-3-chloro-5-(fluoromethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5R)-3-chloro-5-(fluoromethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 118878411 |
| Molecular Formula | C10H13ClFN3O4 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-3-chloro-5-(fluoromethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@@](CO)(CF)[C@@H](O)[C@@H]2Cl)c(=O)n1 |
| InChI | InChI=1S/C10H13ClFN3O4/c11-6-7(17)10(3-12,4-16)19-8(6)15-2-1-5(13)14-9(15)18/h1-2,6-8,16-17H,3-4H2,(H2,13,14,18)/t6-,7-,8+,10+/m0/s1 |
| InChIKey | DYHIEHSKPYBRBC-QHOPCYEYSA-N |
| XLogP | -0.98 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|