C10H15ClFN3O13P3+ — CID 175676116
[(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-2-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-[[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-oxophosphanium (PubChem CID 175676116) has the molecular formula C10H15ClFN3O13P3+ and a molecular weight of 532.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-2-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-[[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-oxophosphanium.
| Compound Name | [(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-2-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-[[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 175676116 |
| Molecular Formula | C10H15ClFN3O13P3+ |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 531.95 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-2-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-[[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-oxophosphanium |
| SMILES | Nc1ccn([C@@H]2O[C@](CF)(CO[P+](=O)OP(=O)(O)OP(=O)(O)OO)[C@@H](O)[C@@H]2Cl)c(=O)n1 |
| InChI | InChI=1S/C10H14ClFN3O13P3/c11-6-7(16)10(3-12,25-8(6)15-2-1-5(13)14-9(15)17)4-24-29(19)27-31(22,23)28-30(20,21)26-18/h1-2,6-8,16H,3-4H2,(H4-,13,14,17,18,20,21,22,23)/p+1/t6-,7-,8+,10+/m0/s1 |
| InChIKey | KPIOBTDHSWHUKJ-QHOPCYEYSA-O |
| XLogP | 0.43 |
| TPSA | 239.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|