C21H23F3N4O — CID 118880156
[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 118880156) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 118880156 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCCC2)N1C[C@@H]2CN(c3ccccc3C(F)(F)F)C[C@@H]2C1 |
| InChI | InChI=1S/C21H23F3N4O/c22-21(23,24)16-6-2-4-8-18(16)27-9-13-11-28(12-14(13)10-27)20(29)19-15-5-1-3-7-17(15)25-26-19/h2,4,6,8,13-14H,1,3,5,7,9-12H2,(H,25,26)/t13-,14+ |
| InChIKey | BTOTUKKTLBYGQY-OKILXGFUSA-N |
| XLogP | 3.52 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |