C18H17F3N4O — CID 123611402
pyrimidin-2-yl-[2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 123611402) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is pyrimidin-2-yl-[2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | pyrimidin-2-yl-[2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 123611402 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | pyrimidin-2-yl-[2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(c1ncccn1)N1CC2CN(c3ccccc3C(F)(F)F)CC2C1 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)14-4-1-2-5-15(14)24-8-12-10-25(11-13(12)9-24)17(26)16-22-6-3-7-23-16/h1-7,12-13H,8-11H2 |
| InChIKey | BCMSVIDBTABZHY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |