C21H16F3N5O — CID 47001606
3-benzyl-2-phenyl-5-(pyrimidin-2-ylamino)-5-(trifluoromethyl)imidazol-4-one (PubChem CID 47001606) has the molecular formula C21H16F3N5O and a molecular weight of 411.39 g/mol. Its IUPAC name is 3-benzyl-2-phenyl-5-(pyrimidin-2-ylamino)-5-(trifluoromethyl)imidazol-4-one.
| Compound Name | 3-benzyl-2-phenyl-5-(pyrimidin-2-ylamino)-5-(trifluoromethyl)imidazol-4-one |
|---|---|
| PubChem CID | 47001606 |
| Molecular Formula | C21H16F3N5O |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 3-benzyl-2-phenyl-5-(pyrimidin-2-ylamino)-5-(trifluoromethyl)imidazol-4-one |
| SMILES | O=C1N(Cc2ccccc2)C(c2ccccc2)=NC1(Nc1ncccn1)C(F)(F)F |
| InChI | InChI=1S/C21H16F3N5O/c22-21(23,24)20(28-19-25-12-7-13-26-19)18(30)29(14-15-8-3-1-4-9-15)17(27-20)16-10-5-2-6-11-16/h1-13H,14H2,(H,25,26,28) |
| InChIKey | HHZQABCGNKLLEA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |