C27H41O3- — CID 11888159
(2S)-2-[(5S,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-6-methylhept-3-enoate (PubChem CID 11888159) has the molecular formula C27H41O3- and a molecular weight of 413.62 g/mol. Its IUPAC name is (2S)-2-[(5S,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-6-methylhept-3-enoate.
| Compound Name | (2S)-2-[(5S,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-6-methylhept-3-enoate |
|---|---|
| PubChem CID | 11888159 |
| Molecular Formula | C27H41O3- |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | (2S)-2-[(5S,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-6-methylhept-3-enoate |
| SMILES | CC(C)CC=C[C@H](C(=O)[O-])C1=CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H42O3/c1-17(2)6-5-7-20(25(29)30)18-12-14-26(3)19(16-18)8-9-21-22-10-11-24(28)27(22,4)15-13-23(21)26/h5,7,12,17,19-24,28H,6,8-11,13-16H2,1-4H3,(H,29,30)/p-1/t19-,20-,21-,22+,23-,24-,26-,27-/m0/s1 |
| InChIKey | XBGUSQBSWPZOOX-FBZFSFNZSA-M |
| XLogP | 4.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|