C30H41FN6O2 — CID 118883061
N-[6-[(diethylaminomethylamino)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]benzimidazol-2-yl]-4-fluorobenzamide (PubChem CID 118883061) has the molecular formula C30H41FN6O2 and a molecular weight of 536.70 g/mol. Its IUPAC name is N-[6-[(diethylaminomethylamino)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]benzimidazol-2-yl]-4-fluorobenzamide.
| Compound Name | N-[6-[(diethylaminomethylamino)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]benzimidazol-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 118883061 |
| Molecular Formula | C30H41FN6O2 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | N-[6-[(diethylaminomethylamino)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]benzimidazol-2-yl]-4-fluorobenzamide |
| SMILES | CCN(CC)CNCc1ccc2nc(NC(=O)c3ccc(F)cc3)n(C3CCC(C(=O)NC(C)C)CC3)c2c1 |
| InChI | InChI=1S/C30H41FN6O2/c1-5-36(6-2)19-32-18-21-7-16-26-27(17-21)37(25-14-10-23(11-15-25)28(38)33-20(3)4)30(34-26)35-29(39)22-8-12-24(31)13-9-22/h7-9,12-13,16-17,20,23,25,32H,5-6,10-11,14-15,18-19H2,1-4H3,(H,33,38)(H,34,35,39) |
| InChIKey | IXAKUHNZYROLEI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|