C31H40FN5O4 — CID 56650357
4-fluoro-N-[6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-1-[4-(methoxycarbamoyl)cyclohexyl]benzimidazol-2-yl]benzamide (PubChem CID 56650357) has the molecular formula C31H40FN5O4 and a molecular weight of 565.69 g/mol. Its IUPAC name is 4-fluoro-N-[6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-1-[4-(methoxycarbamoyl)cyclohexyl]benzimidazol-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-1-[4-(methoxycarbamoyl)cyclohexyl]benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56650357 |
| Molecular Formula | C31H40FN5O4 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 4-fluoro-N-[6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-1-[4-(methoxycarbamoyl)cyclohexyl]benzimidazol-2-yl]benzamide |
| SMILES | CONC(=O)C1CCC(n2c(NC(=O)c3ccc(F)cc3)nc3ccc(CN4CCC(C(C)(C)O)CC4)cc32)CC1 |
| InChI | InChI=1S/C31H40FN5O4/c1-31(2,40)23-14-16-36(17-15-23)19-20-4-13-26-27(18-20)37(25-11-7-22(8-12-25)29(39)35-41-3)30(33-26)34-28(38)21-5-9-24(32)10-6-21/h4-6,9-10,13,18,22-23,25,40H,7-8,11-12,14-17,19H2,1-3H3,(H,35,39)(H,33,34,38) |
| InChIKey | NZYXJVRJQIZEAW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|